2,7-diazaspiro[4.5]decane
2,7-diazaspiro[4.5]decane
CAS: 40247-81-2;40865-50-7
Molecular Formula: C9H14N2O2
2,7-diazaspiro[4.5]decane - Names and Identifiers
| Name | 2,7-diazaspiro[4.5]decane |
| Synonyms | LogP 2,7-Diazaspiro[4.5]decan 2,7-diazaspiro[4.5]decane 9-methyl-2,9-diazaspiro[4.5]decane-1,3-dione 2,7-Diazaspiro[4.5]decane-1,3-dione, 7-Methyl- |
| CAS | 40247-81-2 40865-50-7 |
| InChI | InChI=1/C8H16N2/c1-2-8(6-9-4-1)3-5-10-7-8/h9-10H,1-7H2 |
2,7-diazaspiro[4.5]decane - Physico-chemical Properties
| Molecular Formula | C9H14N2O2 |
| Molar Mass | 182.21966 |
| Density | 1g/cm3 |
| Boling Point | 213.6°C at 760 mmHg |
| Flash Point | 96.1°C |
| Vapor Presure | 0.163mmHg at 25°C |
| Refractive Index | 1.519 |
2,7-diazaspiro[4.5]decane - Introduction
2,7-Diazaspiro [4.5]decane (2,7-diazaspiro[4.5]decane) is an organic compound, also known as DAD, which has the following properties:
1. Appearance: colorless liquid or solid (depending on its physical form).
2. Solubility: Soluble in most organic solvents, such as ether, dimethylformamide and acetone.
3. Melting point and boiling point: the melting point range is 23-27 ℃, and the boiling point is 214-215 ℃.
4. density: about 1.03-1.04g/cm³.
2,7-diazaspiro [4.5] decane main uses include:
1. as an intermediate in organic synthesis: it can be used as an intermediate in the synthesis of other nitrogen-containing compounds, ligands, polymers, etc.
2. as an algaecide: 2,7-diaza spiro [4.5] decane can be used to control the growth of algae in water bodies, for example, for the treatment of ponds, lakes and reservoirs.
the preparation method of 2,7-diazaspiro [4.5] decane can be obtained by the following reaction:
urea and 1,5-pentadiene react with imidazole in aqueous phase to generate hemospirane derivatives, which are then deprotected to obtain 2,7-diazaspiro [4.5] decane.
The following safety information should be noted when using 2,7-diazaspiro [4.5] decane:
1. Avoid contact with skin: Wear gloves and goggles to avoid direct contact with the compound.
2. Keep away from sources of fire: 2,7-diazaspiro [4.5] decane is flammable, so keep away from open flames or other sources of fire during operation or storage.
3. Good ventilation: When exposed to 2,7-diazaspiro [4.5] decane, good ventilation conditions should be maintained to reduce the impact of its vapor or dust on the human body.
4. Storage precautions: 2,7-diazaspiro [4.5] decane should be stored in a sealed container, away from fire and oxidizing agents.
In general, for the use and operation of 2,7-diazaspiro [4.5] decane, the relevant safety operating procedures should be strictly observed and attention should be paid.
1. Appearance: colorless liquid or solid (depending on its physical form).
2. Solubility: Soluble in most organic solvents, such as ether, dimethylformamide and acetone.
3. Melting point and boiling point: the melting point range is 23-27 ℃, and the boiling point is 214-215 ℃.
4. density: about 1.03-1.04g/cm³.
2,7-diazaspiro [4.5] decane main uses include:
1. as an intermediate in organic synthesis: it can be used as an intermediate in the synthesis of other nitrogen-containing compounds, ligands, polymers, etc.
2. as an algaecide: 2,7-diaza spiro [4.5] decane can be used to control the growth of algae in water bodies, for example, for the treatment of ponds, lakes and reservoirs.
the preparation method of 2,7-diazaspiro [4.5] decane can be obtained by the following reaction:
urea and 1,5-pentadiene react with imidazole in aqueous phase to generate hemospirane derivatives, which are then deprotected to obtain 2,7-diazaspiro [4.5] decane.
The following safety information should be noted when using 2,7-diazaspiro [4.5] decane:
1. Avoid contact with skin: Wear gloves and goggles to avoid direct contact with the compound.
2. Keep away from sources of fire: 2,7-diazaspiro [4.5] decane is flammable, so keep away from open flames or other sources of fire during operation or storage.
3. Good ventilation: When exposed to 2,7-diazaspiro [4.5] decane, good ventilation conditions should be maintained to reduce the impact of its vapor or dust on the human body.
4. Storage precautions: 2,7-diazaspiro [4.5] decane should be stored in a sealed container, away from fire and oxidizing agents.
In general, for the use and operation of 2,7-diazaspiro [4.5] decane, the relevant safety operating procedures should be strictly observed and attention should be paid.
Last Update：2024-04-09 20:49:11
![2,7-diazaspiro[4.5]decane](http://res.chembk.com/assets/images/structure/40247-81-2.gif)